EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H79NO9 |
| Net Charge | 0 |
| Average Mass | 754.103 |
| Monoisotopic Mass | 753.57548 |
| SMILES | CCCCCCCCCCCCCCC/C=C/[C@@H](O)C(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)/C=C/CC/C=C(\C)CCCCCCCC |
| InChI | InChI=1S/C43H79NO9/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-22-26-31-37(47)42(51)44-35(33-52-43-41(50)40(49)39(48)38(32-45)53-43)36(46)30-27-23-25-29-34(3)28-24-21-11-9-7-5-2/h26-27,29-31,35-41,43,45-50H,4-25,28,32-33H2,1-3H3,(H,44,51)/b30-27+,31-26+,34-29+/t35-,36+,37+,38+,39+,40-,41+,43+/m0/s1 |
| InChIKey | SSNZBMSHTYMPDC-DDSPGNMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysogeside D (CHEBI:68072) has role Penicillium metabolite (CHEBI:76964) |
| chrysogeside D (CHEBI:68072) is a β-D-glucosylceramide (CHEBI:83264) |
| IUPAC Name |
|---|
| (2R,3E)-N-[(2S,3R,4E,8E)-1-(β-D-glucopyranosyloxy)-3-hydroxy-9-methylheptadeca-4,8-dien-2-yl]-2-hydroxynonadec-3-enamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559832 | Reaxys |
| Citations |
|---|