EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H73NO9 |
| Net Charge | 0 |
| Average Mass | 712.022 |
| Monoisotopic Mass | 711.52853 |
| SMILES | CCCCCCCCCCCCCCC/C=C/[C@@H](O)C(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)/C=C/CC/C=C(\C)CCCCC |
| InChI | InChI=1S/C40H73NO9/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-23-28-34(44)39(48)41-32(30-49-40-38(47)37(46)36(45)35(29-42)50-40)33(43)27-24-20-22-26-31(3)25-21-7-5-2/h23-24,26-28,32-38,40,42-47H,4-22,25,29-30H2,1-3H3,(H,41,48)/b27-24+,28-23+,31-26+/t32-,33+,34+,35+,36+,37-,38+,40+/m0/s1 |
| InChIKey | MPDYYYVKKXHAGJ-JAKQRLLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysogeside C (CHEBI:68071) has role Penicillium metabolite (CHEBI:76964) |
| chrysogeside C (CHEBI:68071) is a β-D-glucosylceramide (CHEBI:83264) |
| IUPAC Name |
|---|
| (2R,3E)-N-[(2S,3R,4E,8E)-1-(β-D-glucopyranosyloxy)-3-hydroxy-9-methyltetradeca-4,8-dien-2-yl]-2-hydroxynonadec-3-enamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559829 | Reaxys |
| Citations |
|---|