EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H40O10 |
| Net Charge | 0 |
| Average Mass | 680.750 |
| Monoisotopic Mass | 680.26215 |
| SMILES | C=C1[C@@H](c2ccc(O)c(OC)c2)O[C@@H](c2ccc(O)c(OC)c2)[C@@]12CCC1=C(C2)[C@@H](c2ccc(O)c(OC)c2)O[C@@H]1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C40H40O10/c1-21-36(22-6-10-28(41)32(16-22)45-2)50-39(25-9-13-31(44)35(19-25)48-5)40(21)15-14-26-27(20-40)38(24-8-12-30(43)34(18-24)47-4)49-37(26)23-7-11-29(42)33(17-23)46-3/h6-13,16-19,36-39,41-44H,1,14-15,20H2,2-5H3/t36-,37+,38+,39-,40+/m0/s1 |
| InChIKey | GVLSMMAPMUCRRO-UHBFVKAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Guaiacum officinale (ncbitaxon:374122) | heartwood (PO:0004512) | PubMed (21391655) | CHCl3 extract of dried and powdered heart wood |
| Guaiacum sanctum (ncbitaxon:45189) | heartwood (PO:0004512) | PubMed (21391655) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ramonanin D, (rel)- (CHEBI:68068) has role metabolite (CHEBI:25212) |
| Ramonanin D, (rel)- (CHEBI:68068) is a diarylheptanoid (CHEBI:78802) |
| Citations |
|---|