EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N3O3 |
| Net Charge | 0 |
| Average Mass | 363.417 |
| Monoisotopic Mass | 363.15829 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)n2c1nc1c(c2=O)C=CC=CO1 |
| InChI | InChI=1S/C21H21N3O3/c1-13(2)17-18-23-20-15(10-6-7-11-27-20)21(26)24(18)16(19(25)22-17)12-14-8-4-3-5-9-14/h3-11,13,16-17H,12H2,1-2H3,(H,22,25)/t16-,17+/m1/s1 |
| InChIKey | HGLNJXVDQPBAOO-SJORKVTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (21366228) | Ethylacetate extract of combined agar media Strain: SF 5044 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protuboxepin B (CHEBI:68056) has role Aspergillus metabolite (CHEBI:76956) |
| protuboxepin B (CHEBI:68056) is a cyclic ether (CHEBI:37407) |
| protuboxepin B (CHEBI:68056) is a lactam (CHEBI:24995) |
| protuboxepin B (CHEBI:68056) is a organic heterotricyclic compound (CHEBI:26979) |
| protuboxepin B (CHEBI:68056) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| (8R*,11S*)-8-benzyl-11-(propan-2-yl)-10,11-dihydro-6H-oxepino[2,3-d]pyrazino[1,2-a]pyrimidine-6,9(8H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548695 | Reaxys |
| Citations |
|---|