EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O3 |
| Net Charge | 0 |
| Average Mass | 424.625 |
| Monoisotopic Mass | 424.29775 |
| SMILES | [H][C@]1([C@H](C)/C=C/[C@H](C)C(C)C)CCC2=C3C=CC4=CC(=O)CC[C@]4(C)[C@@]3(O)[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C28H40O3/c1-17(2)18(3)7-8-19(4)22-11-12-23-24-10-9-20-15-21(29)13-14-27(20,6)28(24,31)25(30)16-26(22,23)5/h7-10,15,17-19,22,25,30-31H,11-14,16H2,1-6H3/b8-7+/t18-,19+,22+,25+,26+,27-,28-/m0/s1 |
| InChIKey | GBAGTCNHJJTJIL-YVVZYAQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangiineae (ncbitaxon:80812) | latex (BTO:0000710) | PubMed (21513291) | Previous component: resin; CHCl3-MeOH extract of cell mass and adsorber resin(XAD-16) Strain: SBNa008 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9α,11α-dihydroxyergosta-4,6,8(14),22-tetraen-3-one (CHEBI:68054) has role antineoplastic agent (CHEBI:35610) |
| 9α,11α-dihydroxyergosta-4,6,8(14),22-tetraen-3-one (CHEBI:68054) has role metabolite (CHEBI:25212) |
| 9α,11α-dihydroxyergosta-4,6,8(14),22-tetraen-3-one (CHEBI:68054) is a 11α-hydroxy steroid (CHEBI:19129) |
| 9α,11α-dihydroxyergosta-4,6,8(14),22-tetraen-3-one (CHEBI:68054) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 9α,11α-dihydroxyergosta-4,6,8(14),22-tetraen-3-one (CHEBI:68054) is a 9-hydroxy steroid (CHEBI:63644) |
| 9α,11α-dihydroxyergosta-4,6,8(14),22-tetraen-3-one (CHEBI:68054) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| rel-(11α,22E)-9,11-dihydroxyergosta-4,6,8(14),22-tetraen-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559820 | Reaxys |
| Citations |
|---|