EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H27Br5N4O10 |
| Net Charge | 0 |
| Average Mass | 1051.128 |
| Monoisotopic Mass | 1045.76440 |
| SMILES | O=C1NCCc2cc(Br)c(O)c(c2)Oc2cc(O)c(cc2Br)CCNC(=O)/C(=N/O)Cc2c(O)cc(Br)c(c2Br)Oc2cc(cc(Br)c2O)C/C1=N\O |
| InChI | InChI=1S/C34H27Br5N4O10/c35-18-10-16-2-4-41-34(49)23(43-51)11-17-25(45)12-21(38)32(29(17)39)53-28-9-15(6-20(37)31(28)47)7-22(42-50)33(48)40-3-1-14-5-19(36)30(46)27(8-14)52-26(18)13-24(16)44/h5-6,8-10,12-13,44-47,50-51H,1-4,7,11H2,(H,40,48)(H,41,49)/b42-22+,43-23+ |
| InChIKey | ZFSTWMBDMZIGJR-GXABEWBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lithothamnion fragilissimum (ncbitaxon:48598) | - | PubMed (21488653) | CH2Cl2-MeOH extract of lyophilized, ground(in presence of dry ice),aqueous extract of frozen alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lithothamnin A (CHEBI:68053) has role metabolite (CHEBI:25212) |
| Lithothamnin A (CHEBI:68053) is a azamacrocycle (CHEBI:52898) |
| Lithothamnin A (CHEBI:68053) is a lactam (CHEBI:24995) |
| Synonym | Source |
|---|---|
| (12E,26E)-5,16,21,34,36-Pentabromo-4,17,23,32-tetrahydroxy-12,26-bis(hydroxyimino)-2,19-dioxa-10,28-diazapentacyclo[29.2.2.1[3,7].1[14,18].1[20,24]]octatriaconta-1(33),3(38),4,6,14(37),15,17,20(36),21 ,23,31,34-dodecaene-11,27-dione | ChEBI |
| Citations |
|---|