EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O7 |
| Net Charge | 0 |
| Average Mass | 410.422 |
| Monoisotopic Mass | 410.13655 |
| SMILES | [H][C@@]12COc3cc(OC)c(OC)cc3[C@]1(O)C(=O)c1ccc3c(c1O2)C=CC(C)(C)O3 |
| InChI | InChI=1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1 |
| InChIKey | AQBZCCQCDWNNJQ-AUSIDOKSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Antheroporum pierrei (IPNI:474590-1) | |||
| leaf (BTO:0000713) | PubMed (21452840) | Dried leaves and twigs were extracted with CH2Cl2/MeOH (1:1) | |
| twig (BTO:0001411) | PubMed (21452840) | Dried leaves and twigs were extracted with CH2Cl2/MeOH (1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tephrosin (CHEBI:9442) has role antineoplastic agent (CHEBI:35610) |
| tephrosin (CHEBI:9442) has role metabolite (CHEBI:25212) |
| tephrosin (CHEBI:9442) has role pesticide (CHEBI:25944) |
| tephrosin (CHEBI:9442) is a aromatic ether (CHEBI:35618) |
| tephrosin (CHEBI:9442) is a cyclic ketone (CHEBI:3992) |
| tephrosin (CHEBI:9442) is a organic heteropentacyclic compound (CHEBI:38164) |
| tephrosin (CHEBI:9442) is a rotenones (CHEBI:72581) |
| Incoming Relation(s) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) has functional parent tephrosin (CHEBI:9442) |
| IUPAC Name |
|---|
| (7aR,13aR)-7a-hydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one |
| Synonyms | Source |
|---|---|
| (7aR,13aR)-13,13a-dihydro-7a-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-bis(1)benzopyrano(3,4-b:6',5'-e)pyran-7(7aH)-one | ChEBI |
| deguelinol I | ChEBI |
| hydroxydeguelin | ChEBI |
| Tephrosin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002578 | KNApSAcK |
| C10535 | KEGG COMPOUND |
| CPD-12165 | MetaCyc |
| DE19707178 | Patent |
| GB350897 | Patent |
| GB437171 | Patent |
| LMPK12060047 | LIPID MAPS |
| Tephrosin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5661956 | Reaxys |
| CAS:76-80-2 | ChemIDplus |
| CAS:76-80-2 | KEGG COMPOUND |
| Citations |
|---|