EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O10 |
| Net Charge | 0 |
| Average Mass | 474.462 |
| Monoisotopic Mass | 474.15260 |
| SMILES | [H][C@@]12COc3cc(OC)c(OC)cc3[C@]1(O)C(=O)c1c(O)cc3c(c1O2)C(OC)C(O)C(C)(C)O3 |
| InChI | InChI=1S/C24H26O10/c1-23(2)22(27)20(31-5)18-15(34-23)7-11(25)17-19(18)33-16-9-32-12-8-14(30-4)13(29-3)6-10(12)24(16,28)21(17)26/h6-8,16,20,22,25,27-28H,9H2,1-5H3/t16-,20?,22?,24-/m1/s1 |
| InChIKey | RTUABMSWXKMPKI-JIEJDMOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia toxicaria (IPNI:520970-1) | stem (BTO:0001300) | PubMed (14510590) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) has functional parent tephrosin (CHEBI:9442) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) has role antineoplastic agent (CHEBI:35610) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) has role metabolite (CHEBI:25212) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) is a aromatic ether (CHEBI:35618) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) is a cyclic ketone (CHEBI:3992) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) is a organic heteropentacyclic compound (CHEBI:38164) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) is a rotenones (CHEBI:72581) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) is a secondary alcohol (CHEBI:35681) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) is a tertiary alcohol (CHEBI:26878) |
| 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin (CHEBI:65772) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (7aR,13aR)-2,6,7a-dihydroxy-1,9,10-trimethoxy-3,3-dimethyl-2,3,13,13a-tetrahydro-1H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one |
| Manual Xrefs | Databases |
|---|---|
| 9937202 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9820416 | Reaxys |
| Citations |
|---|