EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O7 |
| Net Charge | 0 |
| Average Mass | 410.422 |
| Monoisotopic Mass | 410.13655 |
| SMILES | [H][C@@]12COc3cc(OC)c(OC)cc3[C@]1(O)C(=O)c1ccc3c(c1O2)C[C@H](C(=C)C)O3 |
| InChI | InChI=1S/C23H22O7/c1-11(2)16-7-13-15(29-16)6-5-12-21(13)30-20-10-28-17-9-19(27-4)18(26-3)8-14(17)23(20,25)22(12)24/h5-6,8-9,16,20,25H,1,7,10H2,2-4H3/t16-,20-,23-/m1/s1 |
| InChIKey | JFVKWCYZKMUTLH-AYPBNUJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Antheroporum pierrei (IPNI:474590-1) | |||
| leaf (BTO:0000713) | PubMed (21452840) | Dried leaves and twigs were extracted with CH2Cl2/MeOH (1:1) | |
| twig (BTO:0001411) | PubMed (21452840) | Dried leaves and twigs were extracted with CH2Cl2/MeOH (1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12a-hydroxyrotenone (CHEBI:68051) has role metabolite (CHEBI:25212) |
| 12a-hydroxyrotenone (CHEBI:68051) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 12a-Hydroxyrotenone | KEGG COMPOUND |
| (2R,6aR,12aR)-6a-hydroxy-8,9-dimethoxy-2-(prop-1-en-2-yl)-1,2,12,12a-tetrahydrochromeno[3,4-b]furo[2,3-h]chromen-6(6aH)-one | ChEBI |
| Rotenalone I | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10464 | KEGG COMPOUND |
| C00002537 | KNApSAcK |
| HMDB0034145 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:509-96-6 | KEGG COMPOUND |
| CAS:509-96-6 | ChemIDplus |
| Citations |
|---|