EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6805 - methacycline
| Formula | C22H22N2O8 |
| Net Charge | 0 |
| Average Mass | 442.424 |
| Monoisotopic Mass | 442.13762 |
| SMILES | [H][C@@]12C(=C)c3cccc(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]1([H])[C@H]2O |
| InChI | InChI=1S/C22H22N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-6,10,14-15,17,25,27-29,32H,1H2,2-3H3,(H2,23,31)/t10-,14-,15+,17+,22+/m1/s1 |
| InChIKey | MHIGBKBJSQVXNH-IWVLMIASSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methacycline (CHEBI:6805) has role antibacterial agent (CHEBI:33282) |
| methacycline (CHEBI:6805) has role antibacterial drug (CHEBI:36047) |
| methacycline (CHEBI:6805) is a organic molecular entity (CHEBI:50860) |
| methacycline (CHEBI:6805) is a primary carboxamide (CHEBI:140324) |
| methacycline (CHEBI:6805) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| methacycline (CHEBI:6805) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,12aS)-4-(dimethylamino)-3,5,10,12,12a-pentahydroxy-6-methylene-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| metaciclina | ChemIDplus |
| metacycline | KEGG DRUG |
| metacyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-Demethyl-6-deoxy-5-hydroxy-6-methylenetetracycline | ChemIDplus |
| 6-Deoxy-6-demethyl-6-methylene-5-oxytetracycline | ChemIDplus |
| 6-Methylene-5-hydroxytetracycline | ChemIDplus |
| 6-Methylene-5-oxytetracycline | ChemIDplus |
| 6-Methyleneoxytetracycline | ChemIDplus |
| GS-2876 | ChEMBL |
| Citations |
|---|