EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O8 |
| Net Charge | 0 |
| Average Mass | 442.424 |
| Monoisotopic Mass | 442.13762 |
| SMILES | [H][C@@]12C(=C)c3cccc(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]1([H])[C@H]2O |
| InChI | InChI=1S/C22H22N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-6,10,14-15,17,25,27-29,32H,1H2,2-3H3,(H2,23,31)/t10-,14-,15+,17+,22+/m1/s1 |
| InChIKey | MHIGBKBJSQVXNH-IWVLMIASSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methacycline (CHEBI:6805) has role antibacterial drug (CHEBI:36047) |
| methacycline (CHEBI:6805) is a primary carboxamide (CHEBI:140324) |
| methacycline (CHEBI:6805) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| methacycline (CHEBI:6805) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,12aS)-4-(dimethylamino)-3,5,10,12,12a-pentahydroxy-6-methylene-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| metacycline | KEGG DRUG |
| metaciclina | ChemIDplus |
| metacyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Methylenecycline | ChemIDplus |
| 6-Methylene-5-oxytetracycline | ChemIDplus |
| 6-Demethyl-6-deoxy-5-hydroxy-6-methylenetetracycline | ChemIDplus |
| 6-Methyleneoxytetracycline | ChemIDplus |
| Rondomycin | ChemIDplus |
| Tri-methacycline | ChemIDplus |
| Citations |
|---|