EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O7 |
| Net Charge | 0 |
| Average Mass | 452.503 |
| Monoisotopic Mass | 452.18350 |
| SMILES | COc1cc(-c2coc3cc4c(cc3c2=O)C=CC(C)(C)O4)ccc1OC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C26H28O7/c1-25(2)9-8-16-10-17-21(12-20(16)33-25)31-13-18(24(17)28)15-6-7-19(22(11-15)30-5)32-14-23(27)26(3,4)29/h6-13,23,27,29H,14H2,1-5H3/t23-/m1/s1 |
| InChIKey | RDXLWAJRBPKMPD-HSZRJFAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Antheroporum pierrei (IPNI:474590-1) | |||
| leaf (BTO:0000713) | PubMed (21452840) | Dried leaves and twigs were extracted with CH2Cl2/MeOH (1:1) | |
| twig (BTO:0001411) | PubMed (21452840) | Dried leaves and twigs were extracted with CH2Cl2/MeOH (1:1) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pierreione B (CHEBI:68048) has role antineoplastic agent (CHEBI:35610) |
| pierreione B (CHEBI:68048) has role metabolite (CHEBI:25212) |
| pierreione B (CHEBI:68048) has role plant metabolite (CHEBI:76924) |
| pierreione B (CHEBI:68048) is a methoxyisoflavone (CHEBI:38756) |
| IUPAC Name |
|---|
| 7-(4-{[(2R)-2,3-dihydroxy-3-methylbutyl]oxy}-3-methoxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one |
| Synonym | Source |
|---|---|
| 3'-methoxy-4'-(2R,3-dihydroxy-3-methylbutoxyl)-3'',3''-dimethylpyrano-(6,7)-isoflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21431980 | Reaxys |
| Citations |
|---|