EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H77NO7 |
| Net Charge | 0 |
| Average Mass | 708.078 |
| Monoisotopic Mass | 707.57000 |
| SMILES | CCC/C=C\C/C=C\CCC(=O)O[C@@H](COC(=O)CCCCCCCCCCCCC)[C@H](O)[C@H](CO)NC(=O)CCCCCCCCCCC |
| InChI | InChI=1S/C42H77NO7/c1-4-7-10-13-16-19-20-22-25-27-30-33-40(46)49-36-38(50-41(47)34-31-28-24-18-15-12-9-6-3)42(48)37(35-44)43-39(45)32-29-26-23-21-17-14-11-8-5-2/h12,15,24,28,37-38,42,44,48H,4-11,13-14,16-23,25-27,29-36H2,1-3H3,(H,43,45)/b15-12-,28-24-/t37-,38-,42+/m0/s1 |
| InChIKey | YTZVSMIKWGYJCS-KTQSWVMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bathymodiolus thermophilus (ncbitaxon:12966) | gill (BTO:0000518) | PubMed (21222464) | Methanolic extract of tissues from gills |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bathymodiolamide B (CHEBI:68036) has role metabolite (CHEBI:25212) |
| Bathymodiolamide B (CHEBI:68036) is a fatty acid ester (CHEBI:35748) |
| Bathymodiolamide B (CHEBI:68036) is a polyunsaturated fatty ester (CHEBI:145039) |
| Synonyms | Source |
|---|---|
| 2-Deoxy-2-(dodecanoylamino)-5-O-tetradecanoyl-4-O-[(4Z,7Z)-4,7-undecadienoyl]-L-arabinitol | ChEBI |
| [(2S,3R,4S)-4-(dodecanoylamino)-3,5-dihydroxy-2-[(4Z,7Z)-undeca-4,7-dienoyl]oxypentyl] tetradecanoate | ChEBI |
| Citations |
|---|