EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H89NO7 |
| Net Charge | 0 |
| Average Mass | 804.251 |
| Monoisotopic Mass | 803.66390 |
| SMILES | CCC/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@@H](COC(=O)CCCCCCCCCCCCCCC)[C@H](O)[C@H](CO)NC(=O)CCCCCCCCCCC |
| InChI | InChI=1S/C49H89NO7/c1-4-7-10-13-16-19-21-23-25-28-31-34-37-40-47(53)56-43-45(57-48(54)41-38-35-32-29-26-24-22-20-17-14-11-8-5-2)49(55)44(42-51)50-46(52)39-36-33-30-27-18-15-12-9-6-3/h11,14,20,22,26,29,44-45,49,51,55H,4-10,12-13,15-19,21,23-25,27-28,30-43H2,1-3H3,(H,50,52)/b14-11-,22-20-,29-26-/t44-,45-,49+/m0/s1 |
| InChIKey | ZWRWCDYNQPJUJY-MWNPFMMGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bathymodiolus thermophilus (ncbitaxon:12966) | gill (BTO:0000518) | PubMed (21222464) | Methanolic extract of tissues from gills |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bathymodiolamide A (CHEBI:68035) has role metabolite (CHEBI:25212) |
| Bathymodiolamide A (CHEBI:68035) is a polyunsaturated fatty ester (CHEBI:145039) |
| Synonyms | Source |
|---|---|
| [(2S,3R,4S)-4-(dodecanoylamino)-2-[(6Z,9Z,12Z)-hexadeca-6,9,12-trienoyl]oxy-3,5-dihydroxypentyl] hexadecanoate | ChEBI |
| 2-Deoxy-2-(dodecanoylamino)-4-O-[(6Z,9Z,12Z)-6,9,12-hexadecatrienoyl]-5-O-palmitoyl-L-arabinitol | ChEBI |
| Citations |
|---|