EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H38Br2N8O4 |
| Net Charge | 0 |
| Average Mass | 746.505 |
| Monoisotopic Mass | 744.13828 |
| SMILES | N=C(N)NCCCCNC(=O)[C@@]1(O)[C@H](c2cnc3cc(Br)ccc23)[C@@](O)(Cc2cnc3cc(Br)ccc23)C(=O)N1CCCCN |
| InChI | InChI=1S/C31H38Br2N8O4/c32-19-5-7-21-18(16-39-24(21)13-19)15-30(44)26(23-17-40-25-14-20(33)6-8-22(23)25)31(45,41(28(30)43)12-4-1-9-34)27(42)37-10-2-3-11-38-29(35)36/h5-8,13-14,16-17,26,39-40,44-45H,1-4,9-12,15,34H2,(H,37,42)(H4,35,36,38)/t26-,30+,31+/m1/s1 |
| InChIKey | RPGMNINLCSRHGB-JZRGNDHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tegella cf. spitzbergensis (ncbitaxon:546940) | - | PubMed (21370896) | Lyophilized material of the bryozoan was extracted with CH2Cl2/MeOH (1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eusynstyelamide F (CHEBI:68034) has role metabolite (CHEBI:25212) |
| Eusynstyelamide F (CHEBI:68034) is a amino acid amide (CHEBI:22475) |
| Synonym | Source |
|---|---|
| (2S,3R,4S)-1-(4-aminobutyl)-3-(6-bromo-1H-indol-3-yl)-4-[(6-bromo-1H-indol-3-yl)methyl]-N-[4-(diaminomethylideneamino)butyl]-2,4-dihydroxy-5-oxopyrrolidine-2-carboxamide | ChEBI |
| Citations |
|---|