EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36Br2N6O4 |
| Net Charge | 0 |
| Average Mass | 704.464 |
| Monoisotopic Mass | 702.11648 |
| SMILES | NCCCCNC(=O)[C@@]1(O)[C@H](c2cnc3cc(Br)ccc23)[C@@](O)(Cc2cnc3cc(Br)ccc23)C(=O)N1CCCCN |
| InChI | InChI=1S/C30H36Br2N6O4/c31-19-5-7-21-18(16-36-24(21)13-19)15-29(41)26(23-17-37-25-14-20(32)6-8-22(23)25)30(42,27(39)35-11-3-1-9-33)38(28(29)40)12-4-2-10-34/h5-8,13-14,16-17,26,36-37,41-42H,1-4,9-12,15,33-34H2,(H,35,39)/t26-,29+,30+/m1/s1 |
| InChIKey | PIHIJDUVKHNVTR-POLDFPFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tegella cf. spitzbergensis (ncbitaxon:546940) | - | PubMed (21370896) | Lyophilized material of the bryozoan was extracted with CH2Cl2/MeOH (1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eusynstyelamide D (CHEBI:68032) has role metabolite (CHEBI:25212) |
| Eusynstyelamide D (CHEBI:68032) is a amino acid amide (CHEBI:22475) |
| Synonym | Source |
|---|---|
| (2S,3R,4S)-N,1-bis(4-aminobutyl)-3-(6-bromo-1H-indol-3-yl)-4-[(6-bromo-1H-indol-3-yl)methyl]-2,4-dihydroxy-5-oxopyrrolidine-2-carboxamide | ChEBI |
| Citations |
|---|