EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40Br2N10O4 |
| Net Charge | 0 |
| Average Mass | 788.546 |
| Monoisotopic Mass | 786.16007 |
| SMILES | N=C(N)NCCCCNC(=O)[C@@]1(O)[C@H](c2cnc3cc(Br)ccc23)[C@@](O)(Cc2cnc3cc(Br)ccc23)C(=O)N1CCCCNC(=N)N |
| InChI | InChI=1S/C32H40Br2N10O4/c33-19-5-7-21-18(16-42-24(21)13-19)15-31(47)26(23-17-43-25-14-20(34)6-8-22(23)25)32(48,27(45)39-9-1-2-10-40-29(35)36)44(28(31)46)12-4-3-11-41-30(37)38/h5-8,13-14,16-17,26,42-43,47-48H,1-4,9-12,15H2,(H,39,45)(H4,35,36,40)(H4,37,38,41)/t26-,31+,32+/m1/s1 |
| InChIKey | AFCHPUCHYPXZGZ-GWTOPCPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tegella cf. spitzbergensis (ncbitaxon:546940) | - | PubMed (21370896) | Lyophilized material of the bryozoan was extracted with CH2Cl2/MeOH (1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-Eusynstyelamide B, (rel)- (CHEBI:68031) has role metabolite (CHEBI:25212) |
| ent-Eusynstyelamide B, (rel)- (CHEBI:68031) is a amino acid amide (CHEBI:22475) |
| Citations |
|---|