EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O6 |
| Net Charge | 0 |
| Average Mass | 392.492 |
| Monoisotopic Mass | 392.21989 |
| SMILES | [H][C@@]12C(=O)[C@H](O)[C@@H](C)[C@]3(CC[C@@]4(C=COC4)O3)[C@@]1(C)CC[C@@H](OC(C)=O)C2(C)C |
| InChI | InChI=1S/C22H32O6/c1-13-16(24)17(25)18-19(3,4)15(27-14(2)23)6-7-20(18,5)22(13)9-8-21(28-22)10-11-26-12-21/h10-11,13,15-16,18,24H,6-9,12H2,1-5H3/t13-,15-,16-,18+,20+,21+,22-/m1/s1 |
| InChIKey | HOIUWXWVVKJHSD-WQPGSDOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leonurus sibiricus (ncbitaxon:405945) | leaf (BTO:0000713) | PubMed (21375312) | Dried and powdered leaves were extracted with n-hexane |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isopreleosibirone (CHEBI:68027) has role metabolite (CHEBI:25212) |
| Isopreleosibirone (CHEBI:68027) is a diterpenoid (CHEBI:23849) |
| Synonyms | Source |
|---|---|
| 3alpha-acetoxy-9alpha,13S | ChEBI |
| 15,16-diepoxy-7beta-hydroxylabd-14-en-6-one | ChEBI |
| Citations |
|---|