EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O7 |
| Net Charge | 0 |
| Average Mass | 452.503 |
| Monoisotopic Mass | 452.18350 |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)c(C/C=C(\C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C26H28O7/c1-14(2)6-5-7-15(3)8-9-17-18(10-11-20(32-4)23(17)29)26-25(31)24(30)22-19(28)12-16(27)13-21(22)33-26/h6,8,10-13,27-29,31H,5,7,9H2,1-4H3/b15-8+ |
| InChIKey | FQNPIKMQXFBSPC-OVCLIPMQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macaranone B (CHEBI:68024) has functional parent flavonol (CHEBI:5078) |
| macaranone B (CHEBI:68024) has role plant metabolite (CHEBI:76924) |
| macaranone B (CHEBI:68024) is a flavonols (CHEBI:28802) |
| macaranone B (CHEBI:68024) is a monomethoxyflavone (CHEBI:25401) |
| macaranone B (CHEBI:68024) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-{2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3-hydroxy-4-methoxyphenyl}-3,5,7-trihydroxy-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19726970 | Reaxys |
| Citations |
|---|