EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O6 |
| Net Charge | 0 |
| Average Mass | 422.477 |
| Monoisotopic Mass | 422.17294 |
| SMILES | CC(C)=CCc1c(O)cc2oc(-c3ccc(O)cc3O)c(CC=C(C)C)c(=O)c2c1O |
| InChI | InChI=1S/C25H26O6/c1-13(2)5-8-16-20(28)12-21-22(23(16)29)24(30)18(9-6-14(3)4)25(31-21)17-10-7-15(26)11-19(17)27/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| InChIKey | MUUDYSFWQUSAOO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cudraflavone C (CHEBI:68023) has role antibacterial agent (CHEBI:33282) |
| cudraflavone C (CHEBI:68023) has role antineoplastic agent (CHEBI:35610) |
| cudraflavone C (CHEBI:68023) has role plant metabolite (CHEBI:76924) |
| cudraflavone C (CHEBI:68023) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3,6-bis(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| mulberrin | ChEBI |
| 2-(2,4-dihydroxy-phenyl)-5,7-dihydroxy-3,6-bis(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | ChEBI |
| 2',4',5,7-tetrahydroxy-3,6-bis(3-methyl-2-butenyl)flavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12110902 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1334252 | Reaxys |
| CAS:19275-47-9 | ChemIDplus |
| Citations |
|---|