EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O7 |
| Net Charge | 0 |
| Average Mass | 506.595 |
| Monoisotopic Mass | 506.23045 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C[C@@]12Oc3cc(O)cc(O)c3C(=O)[C@]1(O)Oc1cc(O)ccc12 |
| InChI | InChI=1S/C30H34O7/c1-18(2)7-5-8-19(3)9-6-10-20(4)13-14-29-23-12-11-21(31)16-25(23)37-30(29,35)28(34)27-24(33)15-22(32)17-26(27)36-29/h7,9,11-13,15-17,31-33,35H,5-6,8,10,14H2,1-4H3/b19-9+,20-13+/t29-,30-/m0/s1 |
| InChIKey | CPWWQVCCRBAKMX-KHAFAKOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sanggenol H (CHEBI:68022) has role plant metabolite (CHEBI:76924) |
| sanggenol H (CHEBI:68022) is a extended flavonoid (CHEBI:71037) |
| sanggenol H (CHEBI:68022) is a organic heterotetracyclic compound (CHEBI:38163) |
| sanggenol H (CHEBI:68022) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (5aS,10aR)-1,3,8,10a-tetrahydroxy-5a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-5a,10a-dihydro-11H-[1]benzofuro[3,2-b]chromen-11-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21444294 | Reaxys |
| Citations |
|---|