EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O8 |
| Net Charge | 0 |
| Average Mass | 468.502 |
| Monoisotopic Mass | 468.17842 |
| SMILES | [H][C@@]1(C(C)(O)CCC=C(C)C)Cc2c(-c3oc4cc(O)cc(O)c4c(=O)c3OC)ccc(O)c2O1 |
| InChI | InChI=1S/C26H28O8/c1-13(2)6-5-9-26(3,31)20-12-16-15(7-8-17(28)23(16)34-20)24-25(32-4)22(30)21-18(29)10-14(27)11-19(21)33-24/h6-8,10-11,20,27-29,31H,5,9,12H2,1-4H3/t20-,26?/m0/s1 |
| InChIKey | ZFZCFFNYBORJLD-DQUNLGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigrasin j (CHEBI:68021) has role plant metabolite (CHEBI:76924) |
| nigrasin j (CHEBI:68021) is a extended flavonoid (CHEBI:71037) |
| nigrasin j (CHEBI:68021) is a monomethoxyflavone (CHEBI:25401) |
| nigrasin j (CHEBI:68021) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-[(2S)-7-hydroxy-2-(2-hydroxy-6-methylhept-5-en-2-yl)-2,3-dihydro-1-benzofuran-4-yl]-3-methoxy-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21444286 | Reaxys |
| Citations |
|---|