EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6802 - metformin hydrochloride
| Formula | C4H11N5.HCl |
| Net Charge | 0 |
| Average Mass | 165.628 |
| Monoisotopic Mass | 165.07812 |
| SMILES | CN(C)C(=N)NC(=N)N.Cl |
| InChI | InChI=1S/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H |
| InChIKey | OETHQSJEHLVLGH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metformin hydrochloride (CHEBI:6802) has part metformin(1+) (CHEBI:90688) |
| metformin hydrochloride (CHEBI:6802) has role environmental contaminant (CHEBI:78298) |
| metformin hydrochloride (CHEBI:6802) has role hypoglycemic agent (CHEBI:35526) |
| metformin hydrochloride (CHEBI:6802) has role xenobiotic (CHEBI:35703) |
| metformin hydrochloride (CHEBI:6802) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| Synjardy (CHEBI:90875) has part metformin hydrochloride (CHEBI:6802) |
| IUPAC Name |
|---|
| N,N-dimethylimidodicarbonimidic diamide hydrochloride |
| Synonyms | Source |
|---|---|
| Dimethylbiguanide hydrochloride | ChemIDplus |
| 1,1-Dimethylbiguanide hydrochloride | ChemIDplus |
| N,N-Dimethylbiguanide hydrochloride | ChemIDplus |
| N1,N1-Dimethylbiguanide | ChemIDplus |
| Metformin monohydrochloride | ChemIDplus |
| Metformin HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Glucophage | KEGG DRUG |
| Citations |
|---|