EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O8 |
| Net Charge | 0 |
| Average Mass | 522.594 |
| Monoisotopic Mass | 522.22537 |
| SMILES | C=C(C)C(O)CC/C(C)=C/CC/C(C)=C/C[C@@]12Oc3cc(O)cc(O)c3C(=O)[C@]1(O)Oc1cc(O)ccc12 |
| InChI | InChI=1S/C30H34O8/c1-17(2)23(33)11-8-18(3)6-5-7-19(4)12-13-29-22-10-9-20(31)15-25(22)38-30(29,36)28(35)27-24(34)14-21(32)16-26(27)37-29/h6,9-10,12,14-16,23,31-34,36H,1,5,7-8,11,13H2,2-4H3/b18-6+,19-12+/t23?,29-,30-/m0/s1 |
| InChIKey | IZSBTQUUESEKPV-GOMYMHFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigrasin G (CHEBI:68018) has role plant metabolite (CHEBI:76924) |
| nigrasin G (CHEBI:68018) is a extended flavonoid (CHEBI:71037) |
| nigrasin G (CHEBI:68018) is a organic heterotetracyclic compound (CHEBI:38163) |
| nigrasin G (CHEBI:68018) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (5aS,10aR)-1,3,8,10a-tetrahydroxy-5a-[(2E,6E)-10-hydroxy-3,7,11-trimethyldodeca-2,6,11-trien-1-yl]-5a,10a-dihydro-11H-[1]benzofuro[3,2-b]chromen-11-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21444295 | Reaxys |
| Citations |
|---|