EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O7 |
| Net Charge | 0 |
| Average Mass | 436.460 |
| Monoisotopic Mass | 436.15220 |
| SMILES | [H][C@]1(C(=C)C)Cc2c(cc(O)c3c2O[C@]2(CC=C(C)C)c4ccc(O)cc4O[C@]2(O)C3=O)O1 |
| InChI | InChI=1S/C25H24O7/c1-12(2)7-8-24-16-6-5-14(26)9-20(16)31-25(24,29)23(28)21-17(27)11-19-15(22(21)32-24)10-18(30-19)13(3)4/h5-7,9,11,18,26-27,29H,3,8,10H2,1-2,4H3/t18-,24-,25-/m1/s1 |
| InChIKey | HUMOTOGWFSSVMP-ZYKLXPEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigrasin E (CHEBI:68016) has role metabolite (CHEBI:25212) |
| nigrasin E (CHEBI:68016) has role plant metabolite (CHEBI:76924) |
| nigrasin E (CHEBI:68016) is a extended flavonoid (CHEBI:71037) |
| nigrasin E (CHEBI:68016) is a organic heteropentacyclic compound (CHEBI:38164) |
| nigrasin E (CHEBI:68016) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2R*,6aS,11bR)-5,6a,9-trihydroxy-11b-(3-methylbut-2-en-1-yl)-2-(prop-1-en-2-yl)-1,2,6a,11b-tetrahydro-6H-[1]benzofuro[3,2-b]furo[2,3-h]chromen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21444287 | Reaxys |
| Citations |
|---|