EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O8 |
| Net Charge | 0 |
| Average Mass | 454.475 |
| Monoisotopic Mass | 454.16277 |
| SMILES | [H][C@@]1(C(C)(C)O)Cc2c(cc3c(c2O)C(=O)[C@@]2(O)Oc4cc(O)ccc4[C@@]2(CC=C(C)C)O3)O1 |
| InChI | InChI=1S/C25H26O8/c1-12(2)7-8-24-15-6-5-13(26)9-17(15)33-25(24,30)22(28)20-18(32-24)11-16-14(21(20)27)10-19(31-16)23(3,4)29/h5-7,9,11,19,26-27,29-30H,8,10H2,1-4H3/t19-,24+,25+/m0/s1 |
| InChIKey | TXDONVUXISPTKQ-QTLGCAHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigrasin C (CHEBI:68014) has role metabolite (CHEBI:25212) |
| nigrasin C (CHEBI:68014) has role plant metabolite (CHEBI:76924) |
| nigrasin C (CHEBI:68014) is a extended flavonoid (CHEBI:71037) |
| nigrasin C (CHEBI:68014) is a organic heteropentacyclic compound (CHEBI:38164) |
| nigrasin C (CHEBI:68014) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2S*,5aS,10bR)-4,5a,8-trihydroxy-2-(2-hydroxypropan-2-yl)-10b-(3-methylbut-2-en-1-yl)-2,3,5a,10b-tetrahydro-5H-[1]benzofuro[3,2-b]furo[3,2-g]chromen-5-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21444290 | Reaxys |
| Citations |
|---|