EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O8 |
| Net Charge | 0 |
| Average Mass | 454.475 |
| Monoisotopic Mass | 454.16277 |
| SMILES | CC(C)=CC[C@]12Oc3cc4c(c(O)c3C(=O)[C@@]1(O)Oc1cc(O)ccc12)C[C@H](O)C(C)(C)O4 |
| InChI | InChI=1S/C25H26O8/c1-12(2)7-8-24-15-6-5-13(26)9-17(15)33-25(24,30)22(29)20-18(32-24)11-16-14(21(20)28)10-19(27)23(3,4)31-16/h5-7,9,11,19,26-28,30H,8,10H2,1-4H3/t19-,24+,25+/m0/s1 |
| InChIKey | ZLKLBRDQEVVKPJ-QTLGCAHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus nigra (ncbitaxon:85232) | twig (BTO:0001411) | PubMed (21401118) | Milled, air-dried twigs were percolated with 95% ethanol |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigrasin B (CHEBI:68013) has role plant metabolite (CHEBI:76924) |
| nigrasin B (CHEBI:68013) is a extended flavonoid (CHEBI:71037) |
| nigrasin B (CHEBI:68013) is a organic heteropentacyclic compound (CHEBI:38164) |
| nigrasin B (CHEBI:68013) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (3S*,6aS,11bR)-3,5,6a,9-tetrahydroxy-2,2-dimethyl-11b-(3-methylbut-2-en-1-yl)-3,4,6a,11b-tetrahydro-2H,6H-[1]benzofuro[3,2-b]pyrano[3,2-g]chromen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21444293 | Reaxys |
| Citations |
|---|