EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11N5 |
| Net Charge | 0 |
| Average Mass | 129.167 |
| Monoisotopic Mass | 129.10145 |
| SMILES | CN(C)C(=N)NC(=N)N |
| InChI | InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
| InChIKey | XZWYZXLIPXDOLR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metformin (CHEBI:6801) has functional parent biguanide (CHEBI:3095) |
| metformin (CHEBI:6801) has role environmental contaminant (CHEBI:78298) |
| metformin (CHEBI:6801) has role geroprotector (CHEBI:176497) |
| metformin (CHEBI:6801) has role hypoglycemic agent (CHEBI:35526) |
| metformin (CHEBI:6801) has role xenobiotic (CHEBI:35703) |
| metformin (CHEBI:6801) is a guanidines (CHEBI:24436) |
| metformin (CHEBI:6801) is conjugate base of metformin(1+) (CHEBI:90688) |
| Incoming Relation(s) |
| metformin(1+) (CHEBI:90688) is conjugate acid of metformin (CHEBI:6801) |
| IUPAC Name |
|---|
| N,N-dimethyltriimidodicarbonic diamide |
| INNs | Source |
|---|---|
| metformin | WHO MedNet |
| metformina | WHO MedNet |
| metformine | WHO MedNet |
| metforminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,1-dimethylbiguanide | ChemIDplus |
| dimethylbiguanide | ChemIDplus |
| dimethyldiguanide | ChemIDplus |
| N,N-dimethylbiguanide | ChemIDplus |
| N,N-dimethyldiguanide | ChemIDplus |
| N,N-dimethylguanylguanidine | DrugCentral |
| Citations |
|---|