EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5S |
| Net Charge | 0 |
| Average Mass | 384.538 |
| Monoisotopic Mass | 384.19705 |
| SMILES | COc1c(C)c(CCCCCCCCCCSC(C)=O)oc(=O)c1OC |
| InChI | InChI=1S/C20H32O5S/c1-15-17(25-20(22)19(24-4)18(15)23-3)13-11-9-7-5-6-8-10-12-14-26-16(2)21/h5-14H2,1-4H3 |
| InChIKey | OSDVFVPBWCZVHJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plakortis (ncbitaxon:86044) | - | PubMed (21351759) | Methanolic extract of frozen sample |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lehualide H (CHEBI:68008) has role animal metabolite (CHEBI:75767) |
| lehualide H (CHEBI:68008) has role antineoplastic agent (CHEBI:35610) |
| lehualide H (CHEBI:68008) is a 2-pyranones (CHEBI:75885) |
| lehualide H (CHEBI:68008) is a ether (CHEBI:25698) |
| lehualide H (CHEBI:68008) is a polyketide (CHEBI:26188) |
| lehualide H (CHEBI:68008) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-[10-(3,4-dimethoxy-5-methyl-2-oxo-2H-pyran-6-yl)decyl] ethanethioate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21452355 | Reaxys |
| Citations |
|---|