EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O4 |
| Net Charge | 0 |
| Average Mass | 398.543 |
| Monoisotopic Mass | 398.24571 |
| SMILES | COc1c(O)c(C)c(C/C=C(\C)CCCCCCCCc2ccccc2)oc1=O |
| InChI | InChI=1S/C25H34O4/c1-19(17-18-22-20(2)23(26)24(28-3)25(27)29-22)13-9-6-4-5-7-10-14-21-15-11-8-12-16-21/h8,11-12,15-17,26H,4-7,9-10,13-14,18H2,1-3H3/b19-17+ |
| InChIKey | HDTIRSDZUHKVQB-HTXNQAPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plakortis (ncbitaxon:86044) | - | PubMed (21351759) | Methanolic extract of frozen sample |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lehualide G (CHEBI:68007) has role animal metabolite (CHEBI:75767) |
| lehualide G (CHEBI:68007) has role antineoplastic agent (CHEBI:35610) |
| lehualide G (CHEBI:68007) is a 2-pyranones (CHEBI:75885) |
| lehualide G (CHEBI:68007) is a ether (CHEBI:25698) |
| lehualide G (CHEBI:68007) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 4-hydroxy-3-methoxy-5-methyl-6-[(2E)-3-methyl-11-phenylundec-2-en-1-yl]-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21452357 | Reaxys |
| Citations |
|---|