EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O4 |
| Net Charge | 0 |
| Average Mass | 370.489 |
| Monoisotopic Mass | 370.21441 |
| SMILES | COc1c(O)c(C)c(C/C=C(\C)CCCCCCc2ccccc2)oc1=O |
| InChI | InChI=1S/C23H30O4/c1-17(11-7-4-5-8-12-19-13-9-6-10-14-19)15-16-20-18(2)21(24)22(26-3)23(25)27-20/h6,9-10,13-15,24H,4-5,7-8,11-12,16H2,1-3H3/b17-15+ |
| InChIKey | RLHYLTRNTUTEBU-BMRADRMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plakortis (ncbitaxon:86044) | - | PubMed (21351759) | Methanolic extract of frozen sample |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lehualide F (CHEBI:68006) has role antineoplastic agent (CHEBI:35610) |
| lehualide F (CHEBI:68006) has role metabolite (CHEBI:25212) |
| lehualide F (CHEBI:68006) is a 2-pyranones (CHEBI:75885) |
| lehualide F (CHEBI:68006) is a ether (CHEBI:25698) |
| lehualide F (CHEBI:68006) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 4-hydroxy-3-methoxy-5-methyl-6-[(2E)-3-methyl-9-phenylnon-2-en-1-yl]-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21452356 | Reaxys |
| Citations |
|---|