EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N |
| Net Charge | 0 |
| Average Mass | 141.258 |
| Monoisotopic Mass | 141.15175 |
| SMILES | CCC[C@H]1CCC[C@@H](C)N1 |
| InChI | InChI=1S/C9H19N/c1-3-5-9-7-4-6-8(2)10-9/h8-10H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | BHBZNQCZKUGKCJ-BDAKNGLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Picea (ncbitaxon:3328) | - | PubMed (21410219) | |
| Pinus (ncbitaxon:139271) | - | PubMed (21410219) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-dihydropinidine (CHEBI:68002) has role metabolite (CHEBI:25212) |
| (+)-dihydropinidine (CHEBI:68002) is a citraconoyl group (CHEBI:23315) |
| Synonym | Source |
|---|---|
| (2R,6S)-2-methyl-6-propylpiperidine | ChEBI |
| Citations |
|---|