EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@]12C(=C)CC[C@@H](O)[C@]1(C)CC[C@@H](C(C)C)[C@@H]2O |
| InChI | InChI=1S/C15H26O2/c1-9(2)11-7-8-15(4)12(16)6-5-10(3)13(15)14(11)17/h9,11-14,16-17H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15-/m0/s1 |
| InChIKey | WKKJGHCXVKEJNU-QRTUWBSPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton gratissimus (ncbitaxon:316784) | |||
| leaf (BTO:0000713) | PubMed (22032651) | Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves | |
| stem (BTO:0001300) | PubMed (22032651) | Previous component: stem bark; Combined hexane,methylene chloride,ethyl acetate and methanol extract of Ground leaves | |
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1beta,6alpha-dihydroxy-4(14)-eudesmene (CHEBI:68001) has role metabolite (CHEBI:25212) |
| 1beta,6alpha-dihydroxy-4(14)-eudesmene (CHEBI:68001) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| Synonym | Source |
|---|---|
| (1S,2S,4aR,5R,8aS)-2-Isopropyl-4a-methyl-8-methylenedecahydro-1,5-naphthalenediol | ChEBI |
| Citations |
|---|