EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21NO4 |
| Net Charge | 0 |
| Average Mass | 255.314 |
| Monoisotopic Mass | 255.14706 |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1CC2[C@@H](O)[C@@H](O)C(C1)N2C |
| InChI | InChI=1S/C13H21NO4/c1-4-7(2)13(17)18-8-5-9-11(15)12(16)10(6-8)14(9)3/h4,8-12,15-16H,5-6H2,1-3H3/b7-4+/t8-,9?,10?,11-,12+ |
| InChIKey | YZFJTFVPCWEPND-UEGMUGDPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Meteloidine (CHEBI:6800) is a tropane alkaloid (CHEBI:37332) |
| Synonym | Source |
|---|---|
| Meteloidine | KEGG COMPOUND |