EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26O3 |
| Net Charge | 0 |
| Average Mass | 278.392 |
| Monoisotopic Mass | 278.18819 |
| SMILES | C=C[C@H](O)C#CC#CC[C@@H](O)[C@H](O)CCCCCCC |
| InChI | InChI=1S/C17H26O3/c1-3-5-6-7-10-13-16(19)17(20)14-11-8-9-12-15(18)4-2/h4,15-20H,2-3,5-7,10,13-14H2,1H3/t15-,16+,17+/m0/s1 |
| InChIKey | RDIMTXDFGHNINN-GVDBMIGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,9R,10R)-panaxytriol (CHEBI:67998) has role metabolite (CHEBI:25212) |
| (3S,9R,10R)-panaxytriol (CHEBI:67998) is a long-chain fatty alcohol (CHEBI:17135) |
| Synonym | Source |
|---|---|
| (3S,9R,10R)-heptadec-1-en-4,6-diyne-3,9,10-triol | ChEBI |
| Citations |
|---|