EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O2 |
| Net Charge | 0 |
| Average Mass | 260.377 |
| Monoisotopic Mass | 260.17763 |
| SMILES | C=C[C@H](O)C#CC#C/C=C/[C@@H](O)CCCCCCC |
| InChI | InChI=1S/C17H24O2/c1-3-5-6-7-11-14-17(19)15-12-9-8-10-13-16(18)4-2/h4,12,15-19H,2-3,5-7,11,14H2,1H3/b15-12+/t16-,17-/m0/s1 |
| InChIKey | DSVMWGREWREVQQ-LHGWUTHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,10S)-panaxydiol (CHEBI:67997) has role metabolite (CHEBI:25212) |
| (3S,10S)-panaxydiol (CHEBI:67997) is a long-chain fatty alcohol (CHEBI:17135) |
| Citations |
|---|