EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C54H92O23 |
| Net Charge | 0 |
| Average Mass | 1109.307 |
| Monoisotopic Mass | 1108.60294 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(CCC=C(C)C)O[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C54H92O23/c1-23(2)10-9-14-54(8,77-48-44(69)40(65)37(62)29(74-48)22-70-46-42(67)38(63)34(59)26(19-55)71-46)24-11-16-53(7)33(24)25(58)18-31-51(5)15-13-32(50(3,4)30(51)12-17-52(31,53)6)75-49-45(41(66)36(61)28(21-57)73-49)76-47-43(68)39(64)35(60)27(20-56)72-47/h10,24-49,55-69H,9,11-22H2,1-8H3/t24-,25+,26+,27+,28+,29+,30-,31+,32-,33-,34+,35+,36+,37+,38-,39-,40-,41-,42+,43+,44+,45+,46+,47-,48-,49-,51-,52+,53+,54-/m0/s1 |
| InChIKey | GZYPWOGIYAIIPV-JBDTYSNRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. anti-obesity agent Any substance which is used to reduce or control weight. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside Rb1 (CHEBI:67989) has functional parent ginsenoside Rd (CHEBI:67988) |
| ginsenoside Rb1 (CHEBI:67989) has role anti-inflammatory drug (CHEBI:35472) |
| ginsenoside Rb1 (CHEBI:67989) has role anti-obesity agent (CHEBI:74518) |
| ginsenoside Rb1 (CHEBI:67989) has role apoptosis inhibitor (CHEBI:68494) |
| ginsenoside Rb1 (CHEBI:67989) has role neuroprotective agent (CHEBI:63726) |
| ginsenoside Rb1 (CHEBI:67989) has role plant metabolite (CHEBI:76924) |
| ginsenoside Rb1 (CHEBI:67989) has role radical scavenger (CHEBI:48578) |
| ginsenoside Rb1 (CHEBI:67989) is a ginsenoside (CHEBI:74978) |
| ginsenoside Rb1 (CHEBI:67989) is a glycoside (CHEBI:24400) |
| ginsenoside Rb1 (CHEBI:67989) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β,12β)-20-{[6-O-(β-D-glucopyranosyl)-β-D-glucopyranosyl]oxy}-12-hydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 20(S)-ginsenoside Rb1 | ChEBI |
| 2-O-β-glucopyranosyl-(3β,12β)-20-((6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy)-12-hydroxydammar-24-en-3-yl-β-D-glucopyranoside | ChemIDplus |
| (3β,12β)-20-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside | ChEBI |
| arasaponin E1 | ChemIDplus |
| GS-Rb1 | ChEBI |
| GSRb1 | ChEBI |
| UniProt Name | Source |
|---|---|
| (20S)-ginsenoside Rb1 | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4901825 | Reaxys |
| CAS:41753-43-9 | ChemIDplus |
| Citations |
|---|