EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H72O14 |
| Net Charge | 0 |
| Average Mass | 801.024 |
| Monoisotopic Mass | 800.49221 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(CCC=C(C)C)O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3(C)[C@]1(C)C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C42H72O14/c1-20(2)10-9-13-42(8,56-37-34(52)32(50)30(48)25(19-44)55-37)21-11-15-40(6)28(21)22(45)16-26-39(5)14-12-27(46)38(3,4)35(39)23(17-41(26,40)7)53-36-33(51)31(49)29(47)24(18-43)54-36/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23-,24+,25+,26+,27-,28-,29+,30+,31-,32-,33+,34+,35-,36+,37-,39+,40+,41+,42-/m0/s1 |
| InChIKey | YURJSTAIMNSZAE-HHNZYBFYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | pro-angiogenic agent Any compound that promotes the growth of new blood vessels from pre-existing vessels. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside Rg1 (CHEBI:67987) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside Rg1 (CHEBI:67987) has role neuroprotective agent (CHEBI:63726) |
| ginsenoside Rg1 (CHEBI:67987) has role pro-angiogenic agent (CHEBI:72571) |
| ginsenoside Rg1 (CHEBI:67987) is a 12β-hydroxy steroid (CHEBI:36847) |
| ginsenoside Rg1 (CHEBI:67987) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| ginsenoside Rg1 (CHEBI:67987) is a ginsenoside (CHEBI:74978) |
| ginsenoside Rg1 (CHEBI:67987) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside Rg1 (CHEBI:67987) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,α,12β)-20-(β-D-glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (3β,6α,12β)-3,12-dihydroxydammar-24-ene-6,20-diyl bis-β-D-glucopyranoside | ChemIDplus |
| Ginsenoside A2 | ChemIDplus |
| Ginsenoside Rg1 | KEGG COMPOUND |
| Panaxoside A | ChemIDplus |
| Panaxoside Rg1 | ChemIDplus |
| Rg1 | ChEBI |
| UniProt Name | Source |
|---|---|
| (20S)-ginsenoside Rg1 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003520 | KNApSAcK |
| C08946 | KEGG COMPOUND |
| DB06750 | DrugBank |
| Ginsenoside_Rg1#Rg1 | Wikipedia |
| HMDB0035857 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:22427-39-0 | ChemIDplus |
| CAS:22427-39-0 | KEGG COMPOUND |
| Citations |
|---|