EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H72O14 |
| Net Charge | 0 |
| Average Mass | 801.024 |
| Monoisotopic Mass | 800.49221 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@@](C)(O)CCC=C(C)C)CC[C@@]3(C)[C@]1(C)C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C42H72O14/c1-20(2)10-9-13-42(8,52)21-11-15-40(6)28(21)22(45)16-26-39(5)14-12-27(46)38(3,4)35(39)23(17-41(26,40)7)53-37-34(32(50)30(48)25(19-44)55-37)56-36-33(51)31(49)29(47)24(18-43)54-36/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23-,24+,25+,26+,27-,28-,29+,30+,31-,32-,33+,34+,35-,36-,37+,39+,40+,41+,42-/m0/s1 |
| InChIKey | UZIOUZHBUYLDHW-XUBRWZAZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside Rf (CHEBI:67986) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside Rf (CHEBI:67986) has role antineoplastic agent (CHEBI:35610) |
| ginsenoside Rf (CHEBI:67986) has role apoptosis inducer (CHEBI:68495) |
| ginsenoside Rf (CHEBI:67986) has role plant metabolite (CHEBI:76924) |
| ginsenoside Rf (CHEBI:67986) is a 12β-hydroxy steroid (CHEBI:36847) |
| ginsenoside Rf (CHEBI:67986) is a 20-hydroxy steroid (CHEBI:36854) |
| ginsenoside Rf (CHEBI:67986) is a 3β-hydroxy steroid (CHEBI:36836) |
| ginsenoside Rf (CHEBI:67986) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| ginsenoside Rf (CHEBI:67986) is a disaccharide derivative (CHEBI:63353) |
| ginsenoside Rf (CHEBI:67986) is a ginsenoside (CHEBI:74978) |
| ginsenoside Rf (CHEBI:67986) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside Rf (CHEBI:67986) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (β,6α,12β)-3,12,20-trihydroxydammar-24-en-6-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Panaxoside RF | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00003519 | KNApSAcK |
| C08945 | KEGG COMPOUND |
| CPD-15441 | MetaCyc |
| HMDB0034745 | HMDB |
| US2007224297 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5721199 | Reaxys |
| CAS:52286-58-5 | ChemIDplus |
| CAS:52286-58-5 | KEGG COMPOUND |
| Citations |
|---|