EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16ClN3O |
| Net Charge | 0 |
| Average Mass | 277.755 |
| Monoisotopic Mass | 277.09819 |
| SMILES | Cc1cccc(C)c1N(Cn1cccn1)C(=O)CCl |
| InChI | InChI=1S/C14H16ClN3O/c1-11-5-3-6-12(2)14(11)18(13(19)9-15)10-17-8-4-7-16-17/h3-8H,9-10H2,1-2H3 |
| InChIKey | STEPQTYSZVCJPV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metazachlor (CHEBI:6798) has role environmental contaminant (CHEBI:78298) |
| metazachlor (CHEBI:6798) has role herbicide (CHEBI:24527) |
| metazachlor (CHEBI:6798) has role xenobiotic (CHEBI:35703) |
| metazachlor (CHEBI:6798) is a aromatic amide (CHEBI:62733) |
| metazachlor (CHEBI:6798) is a organochlorine compound (CHEBI:36683) |
| metazachlor (CHEBI:6798) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 2-chloro-N-(2,6-dimethylphenyl)-N-(1H-pyrazol-1-ylmethyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| C10948 | KEGG COMPOUND |
| metazachlor | Alan Wood's Pesticides |
| 450 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:621550 | Reaxys |
| CAS:67129-08-2 | KEGG COMPOUND |
| CAS:67129-08-2 | ChemIDplus |
| CAS:67129-08-2 | NIST Chemistry WebBook |
| Citations |
|---|