EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O9 |
| Net Charge | 0 |
| Average Mass | 368.338 |
| Monoisotopic Mass | 368.11073 |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O)[C@H](Oc2cc(O)c3c(=O)oc(C)cc3c2)O[C@@H]1CO |
| InChI | InChI=1S/C17H20O9/c1-7-3-8-4-9(5-10(19)12(8)16(22)24-7)25-17-14(21)13(20)15(23-2)11(6-18)26-17/h3-5,11,13-15,17-21H,6H2,1-2H3/t11-,13-,14-,15-,17-/m1/s1 |
| InChIKey | JJNFYWPRBHMFEY-WDGOXLLCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella tenuis (ncbitaxon:1105321) | - | PubMed (21473608) | Ethyl acetate extract of culture broth Strain: BCC 18627 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-6-((2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxytetrahydro-2H-pyran-2-yloxy)-8-hydroxy-3-methyl-1H-isochromen-1-one (CHEBI:67971) has role metabolite (CHEBI:25212) |
| (-)-6-((2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxytetrahydro-2H-pyran-2-yloxy)-8-hydroxy-3-methyl-1H-isochromen-1-one (CHEBI:67971) is a isocoumarins (CHEBI:38758) |
| Citations |
|---|