EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O10 |
| Net Charge | 0 |
| Average Mass | 398.364 |
| Monoisotopic Mass | 398.12130 |
| SMILES | COc1c(O[C@@H]2O[C@H](CO)[C@@H](OC)[C@H](O)[C@H]2O)cc(O)c2c(=O)oc(C)cc12 |
| InChI | InChI=1S/C18H22O10/c1-7-4-8-12(17(23)26-7)9(20)5-10(15(8)24-2)27-18-14(22)13(21)16(25-3)11(6-19)28-18/h4-5,11,13-14,16,18-22H,6H2,1-3H3/t11-,13-,14-,16-,18-/m1/s1 |
| InChIKey | AQZCWLSWPSBFPW-RLFYXJIXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella tenuis (ncbitaxon:1105321) | - | PubMed (21473608) | Strain: BCC 18627 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-6,8-Dihydroxy-5-methoxy-3-methylisocoumarin 6-O-(4-O-methyl-beta-D-glucopyranoside) (CHEBI:67970) has role metabolite (CHEBI:25212) |
| (-)-6,8-Dihydroxy-5-methoxy-3-methylisocoumarin 6-O-(4-O-methyl-beta-D-glucopyranoside) (CHEBI:67970) is a isocoumarins (CHEBI:38758) |
| Citations |
|---|