EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H38O12 |
| Net Charge | 0 |
| Average Mass | 662.688 |
| Monoisotopic Mass | 662.23633 |
| SMILES | COc1cc(OC)c2c(O)c3c(c(-c4c5c(c(O)c6c(OC)cc(OC)cc46)CO[C@@H](C)[C@H]5OC(C)=O)c2c1)[C@H](OC(C)=O)[C@H](C)OC3 |
| InChI | InChI=1S/C36H38O12/c1-15-35(47-17(3)37)31-23(13-45-15)33(39)27-21(9-19(41-5)11-25(27)43-7)29(31)30-22-10-20(42-6)12-26(44-8)28(22)34(40)24-14-46-16(2)36(32(24)30)48-18(4)38/h9-12,15-16,35-36,39-40H,13-14H2,1-8H3/t15-,16-,35+,36+/m0/s1 |
| InChIKey | PEDZYCDSAWVMRN-DZEHZSJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella tenuis (ncbitaxon:1105321) | |||
| mycelium (BTO:0001436) | PubMed (21473608) | Strain: BCC 18627 | |
| - | PubMed (21473608) | Ethyl acetate extract of culture broth Strain: BCC 18627 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,3'S,4S,4'S,5R)-10,10'-dihydroxy-7,7',9,9'-tetramethoxy-3,3'-dimethyl-3,3',4,4'-tetrahydro-1H,1'H-5,5'-bibenzo[g]isochromene-4,4'-diyl diacetate (CHEBI:67967) has role metabolite (CHEBI:25212) |
| (3S,3'S,4S,4'S,5R)-10,10'-dihydroxy-7,7',9,9'-tetramethoxy-3,3'-dimethyl-3,3',4,4'-tetrahydro-1H,1'H-5,5'-bibenzo[g]isochromene-4,4'-diyl diacetate (CHEBI:67967) is a lignan (CHEBI:25036) |
| Citations |
|---|