EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O2 |
| Net Charge | 0 |
| Average Mass | 444.744 |
| Monoisotopic Mass | 444.39673 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(C[C@H](O)[C@@]4([H])C(C)(C)CCC[C@]34C)[C@]1(C)CC[C@@]1([H])[C@@H](C(C)(C)O)CC[C@]21C |
| InChI | InChI=1S/C30H52O2/c1-25(2)14-9-15-28(6)23-11-10-22-27(5)16-12-19(26(3,4)32)20(27)13-17-29(22,7)30(23,8)18-21(31)24(25)28/h19-24,31-32H,9-18H2,1-8H3/t19-,20-,21-,22+,23+,24-,27-,28+,29+,30+/m0/s1 |
| InChIKey | KYBLAIAGFNCVHL-PMVHANJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aschersonia (ncbitaxon:100986) | - | PubMed (21473608) | Produced as a mixture of zeorin,dustatin and 3beta-acetoxyhopane-15a,22-diol |
| Conoideocrella (ncbitaxon:1105318) | - | PubMed (21473608) | |
| Conoideocrella tenuis (ncbitaxon:1105321) | mycelium (BTO:0001436) | PubMed (21473608) | Filtrate of mycelia macerated with methanol Strain: BCC 18627 |
| Hypocrella (ncbitaxon:42305) | - | PubMed (21473608) | Produced as a mixture of zeorin,dustatin and 3beta-acetoxyhopane-15a,22-diol |
| Moelleriella (ncbitaxon:511189) | - | PubMed (21473608) | Produced as a mixture of zeorin,dustatin and 3beta-acetoxyhopane-15a,22-diol |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeorin (CHEBI:67966) has role fungal metabolite (CHEBI:76946) |
| zeorin (CHEBI:67966) is a diol (CHEBI:23824) |
| zeorin (CHEBI:67966) is a hopanoid (CHEBI:51963) |
| zeorin (CHEBI:67966) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (6α)-hopane-6,22-diol |
| Synonym | Source |
|---|---|
| A'-Neogammacerane-6,22-diol, (6alpha)- | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2567368 | Reaxys |
| CAS:22570-53-2 | ChemIDplus |
| Citations |
|---|