EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O3 |
| Net Charge | 0 |
| Average Mass | 460.743 |
| Monoisotopic Mass | 460.39165 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CCCC(C)(C)[C@]4([H])[C@H](O)[C@H](O)[C@@]3(C)[C@]1(C)CC[C@@]1([H])[C@@H](C(C)(C)O)CC[C@]21C |
| InChI | InChI=1S/C30H52O3/c1-25(2)14-9-15-28(6)21-11-10-20-27(5)16-12-18(26(3,4)33)19(27)13-17-29(20,7)30(21,8)24(32)22(31)23(25)28/h18-24,31-33H,9-17H2,1-8H3/t18-,19-,20+,21+,22-,23-,24-,27-,28+,29+,30-/m0/s1 |
| InChIKey | VYLJAYXZTOTZRR-QKJSLZMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella tenuis (ncbitaxon:1105321) | mycelium (BTO:0001436) | PubMed (21473608) | Filtrate of mycelia macerated with methanol Strain: BCC 18627 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hopane-6β,7β,22-triol (CHEBI:67965) has role fungal metabolite (CHEBI:76946) |
| hopane-6β,7β,22-triol (CHEBI:67965) is a hopanoid (CHEBI:51963) |
| hopane-6β,7β,22-triol (CHEBI:67965) is a pentacyclic triterpenoid (CHEBI:25872) |
| hopane-6β,7β,22-triol (CHEBI:67965) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (6β,7β)-hopane-6,7,22-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21448551 | Reaxys |
| Citations |
|---|