EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O4 |
| Net Charge | 0 |
| Average Mass | 474.726 |
| Monoisotopic Mass | 474.37091 |
| SMILES | [H][C@]12C[C@@H](O)[C@@]3([H])[C@@](C)(C[C@@H](O)[C@@]4([H])C(C)(C)CCC[C@]34C)[C@]1(C=O)CC[C@@]1([H])[C@@H](C(C)(C)O)CC[C@]21C |
| InChI | InChI=1S/C30H50O4/c1-25(2)11-8-12-28(6)23(25)21(33)16-29(7)24(28)20(32)15-22-27(5)13-9-18(26(3,4)34)19(27)10-14-30(22,29)17-31/h17-24,32-34H,8-16H2,1-7H3/t18-,19-,20+,21+,22+,23-,24+,27-,28-,29+,30-/m0/s1 |
| InChIKey | HNKBWPYYJWLMQY-ZEZQLZSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella tenuis (ncbitaxon:1105321) | mycelium (BTO:0001436) | PubMed (21473608) | Filtrate of mycelia macerated with methanol Strain: BCC 18627 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-hopan-27-al-6β,11α,22-triol (CHEBI:67963) has role fungal metabolite (CHEBI:76946) |
| rel-hopan-27-al-6β,11α,22-triol (CHEBI:67963) is a aldehyde (CHEBI:17478) |
| rel-hopan-27-al-6β,11α,22-triol (CHEBI:67963) is a hopanoid (CHEBI:51963) |
| rel-hopan-27-al-6β,11α,22-triol (CHEBI:67963) is a pentacyclic triterpenoid (CHEBI:25872) |
| rel-hopan-27-al-6β,11α,22-triol (CHEBI:67963) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (6β,11α)-6,11,22-trihydroxyhopan-27-al |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21448552 | Reaxys |
| Citations |
|---|