EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H51N5O12 |
| Net Charge | 0 |
| Average Mass | 805.882 |
| Monoisotopic Mass | 805.35342 |
| SMILES | COC(=O)[C@@H](Cc1ccc(OC/C=C(\C)CO)cc1)NC(=O)[C@@H](CO)NC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C41H51N5O12/c1-25(23-47)17-18-58-31-15-11-29(12-16-31)20-33(41(56)57-3)45-39(54)34(24-48)46-38(53)32(19-28-9-13-30(49)14-10-28)44-36(51)22-42-37(52)26(2)43-40(55)35(50)21-27-7-5-4-6-8-27/h4-17,26,32-35,47-50H,18-24H2,1-3H3,(H,42,52)(H,43,55)(H,44,51)(H,45,54)(H,46,53)/b25-17+/t26-,32+,33+,34+,35-/m0/s1 |
| InChIKey | WVTCLNOGGTVDPI-AHWJTRECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella tenuis (ncbitaxon:1105321) | - | PubMed (21473608) | Ethyl acetate extract of culture broth Strain: BCC 18627 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Conoideocrellide D (CHEBI:67962) has role metabolite (CHEBI:25212) |
| Conoideocrellide D (CHEBI:67962) is a peptide (CHEBI:16670) |
| Citations |
|---|