EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H50O10 |
| Net Charge | 0 |
| Average Mass | 642.786 |
| Monoisotopic Mass | 642.34040 |
| SMILES | [H][C@@]12C[C@@H](O)C=C3[C@@H](OC(C)=O)O[C@H](OC(C)=O)[C@]31[C@@H](OC(C)=O)[C@H](OC(=O)/C=C\C=C\CCCCC)[C@@H](C)[C@@]2(C)CCC(=C)C=C |
| InChI | InChI=1S/C36H50O10/c1-9-11-12-13-14-15-16-17-30(41)45-31-23(4)35(8,19-18-22(3)10-2)29-21-27(40)20-28-33(43-25(6)38)46-34(44-26(7)39)36(28,29)32(31)42-24(5)37/h10,14-17,20,23,27,29,31-34,40H,2-3,9,11-13,18-19,21H2,1,4-8H3/b15-14+,17-16-/t23-,27+,29+,31-,32+,33+,34+,35-,36-/m1/s1 |
| InChIKey | KAIWHFAEAXEXOF-PDNIMGFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Casearia rupestris (IPNI:48080-2) | leaf (BTO:0000713) | PubMed (21381705) | Diethyl ether phase of the ethanolic extract of dried, ground, macerated leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Casearupestrin D, (rel)- (CHEBI:67958) has role metabolite (CHEBI:25212) |
| Casearupestrin D, (rel)- (CHEBI:67958) is a naphthofuran (CHEBI:39270) |
| Citations |
|---|