EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O9 |
| Net Charge | 0 |
| Average Mass | 600.749 |
| Monoisotopic Mass | 600.32983 |
| SMILES | [H][C@@]12C[C@@H](O)C=C3[C@@H](OC(C)=O)O[C@H](OC(C)=O)[C@]31[C@@H](OC(=O)/C=C\C=C\CCCCC)[C@H](O)[C@@H](C)[C@@]2(C)CCC(=C)C=C |
| InChI | InChI=1S/C34H48O9/c1-8-10-11-12-13-14-15-16-28(38)42-30-29(39)22(4)33(7,18-17-21(3)9-2)27-20-25(37)19-26-31(40-23(5)35)43-32(34(26,27)30)41-24(6)36/h9,13-16,19,22,25,27,29-32,37,39H,2-3,8,10-12,17-18,20H2,1,4-7H3/b14-13+,16-15-/t22-,25+,27+,29-,30+,31+,32+,33-,34-/m1/s1 |
| InChIKey | NWTYSAQBDRQWLF-WWRGVMLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Casearia rupestris (IPNI:48080-2) | leaf (BTO:0000713) | PubMed (21381705) | Diethyl ether phase of the ethanolic extract of dried, ground, macerated leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Casearupestrin A, (rel)- (CHEBI:67955) has role metabolite (CHEBI:25212) |
| Casearupestrin A, (rel)- (CHEBI:67955) is a naphthofuran (CHEBI:39270) |
| Citations |
|---|