EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H50O2/c1-18(2)19-11-13-27(5)15-16-29(7)20(24(19)27)9-10-23-28(6)17-21(31)25(32)26(3,4)22(28)12-14-30(23,29)8/h19-25,31-32H,1,9-17H2,2-8H3/t19-,20+,21+,22-,23+,24+,25-,27+,28-,29+,30+/m0/s1 |
| InChIKey | OESLKRXCBRUCJZ-BUXXFNAFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans sinensis (ncbitaxon:442437-1) | |||
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α,3β-dihydroxylup-20(29)-ene (CHEBI:67954) has parent hydride lupane (CHEBI:36485) |
| 2α,3β-dihydroxylup-20(29)-ene (CHEBI:67954) has role plant metabolite (CHEBI:76924) |
| 2α,3β-dihydroxylup-20(29)-ene (CHEBI:67954) is a diol (CHEBI:23824) |
| 2α,3β-dihydroxylup-20(29)-ene (CHEBI:67954) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 2α,3bβ-lup-20(29)-ene-2,3-diol |
| Citations |
|---|