EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)CCC(=O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H46O4/c1-18-9-14-30(25(33)34)16-15-28(5)20(24(30)19(18)2)7-8-22-26(3)12-11-23(32)27(4,17-31)21(26)10-13-29(22,28)6/h7,18-19,21-22,24,31H,8-17H2,1-6H3,(H,33,34)/t18-,19+,21-,22-,24+,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | RWFVBIQKMCLKMM-CARKBDGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans sinensis (ncbitaxon:442437-1) | |||
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxo-23-hydroxyurs-12-en-28-oic acid (CHEBI:67951) has parent hydride ursane (CHEBI:35711) |
| 3-oxo-23-hydroxyurs-12-en-28-oic acid (CHEBI:67951) has role plant metabolite (CHEBI:76924) |
| 3-oxo-23-hydroxyurs-12-en-28-oic acid (CHEBI:67951) is a cyclic terpene ketone (CHEBI:36130) |
| 3-oxo-23-hydroxyurs-12-en-28-oic acid (CHEBI:67951) is a monocarboxylic acid (CHEBI:25384) |
| 3-oxo-23-hydroxyurs-12-en-28-oic acid (CHEBI:67951) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 23-hydroxy-3-oxours-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6988922 | Reaxys |
| Citations |
|---|